Products 231295-84-4
CAS 231295-84-4 is the registry number for 4,5-Dichloro-1h-indole-2-carboxylic acid, 97%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
4,5-dichloro-1H-indole-2-carboxylic acid (CAS 231295-84-4) is a chemical compound with the molecular formula C9H5Cl2NO2 and a molecular weight of 230.04 g/mol. IUPAC name: 4,5-dichloro-1H-indole-2-carboxylic acid. InChIKey: STMAOBOTFAMOLD-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO2 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 4,5-dichloro-1H-indole-2-carboxylic acid |
| InChIKey | STMAOBOTFAMOLD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NC(=C2)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)