cas: 401622-74-0 — see every product listed under this CAS number, including other names
4,5-Dihydronaphtho[2,1-d]thiazol-2-amine 95% (CAS 401622-74-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A911050-100mg |
| cas | 401622-74-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 526.12 Pln | |
| Ambeed | 250mg | 837.62 Pln | |
| Ambeed | 1g | 2161.50 Pln | |
| Ambeed | 5g | 7924.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A911050 |
4,5-dihydrobenzo[g][1,3]benzothiazol-2-amine (CAS 401622-74-0) is a chemical compound with the molecular formula C11H10N2S and a molecular weight of 202.28 g/mol. IUPAC name: 4,5-dihydrobenzo[g][1,3]benzothiazol-2-amine. InChIKey: NBJZFXQLZREGNR-UHFFFAOYSA-N.
| Molecular formula | C11H10N2S |
|---|---|
| Molecular weight | 202.28 g/mol |
| IUPAC name | 4,5-dihydrobenzo[g][1,3]benzothiazol-2-amine |
| InChIKey | NBJZFXQLZREGNR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C3=CC=CC=C31)SC(=N2)N |
Computed by PubChem (NCBI)