4,6-Dichloro-3-nitropyridin-2-amine, 97%
cas: 37660-64-3 — see every product listed under this CAS number, including other names
4,6-Dichloro-3-nitropyridin-2-amine, 97% (CAS 37660-64-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g. Offered by: Combi-blocks, Ambeed, BLDpharm, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | QN-5966-250mg |
| cas | 37660-64-3 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1471.75 Pln | |
| Ambeed | 25g | 5471.19 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 192.18 Pln | |
| BLDpharm | 1g | 408.77 Pln | |
| BLDpharm | 5g | 1580.58 Pln | |
| BLDpharm | 25g | 5362.58 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 290.00 Pln | |
| Chemat | 5g | 1115.60 Pln | |
| Chemat | 10g | 1744.40 Pln | |
| Fluorochem | 100mg | 112.48 Pln | |
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 388.42 Pln | |
| Fluorochem | 5g | 1513.03 Pln | |
| Fluorochem | 10g | 2950.02 Pln | |
| Fluorochem | 25g | 5600.13 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4,6-dichloro-3-nitropyridin-2-amine (CAS 37660-64-3) is a chemical compound with the molecular formula C5H3Cl2N3O2 and a molecular weight of 208.00 g/mol. IUPAC name: 4,6-dichloro-3-nitropyridin-2-amine. InChIKey: JHRWWIQRZCVYJZ-UHFFFAOYSA-N.
| Molecular formula | C5H3Cl2N3O2 |
|---|---|
| Molecular weight | 208.00 g/mol |
| IUPAC name | 4,6-dichloro-3-nitropyridin-2-amine |
| InChIKey | JHRWWIQRZCVYJZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)N)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)