CAS 1555389-67-7 appears in our catalog under these names: 2-Amino-4,6-dichloro-pyrimidine-5-carboxylic acid, 95%, 2-Amino-4,6-dichloropyrimidine-5-carboxylic acid, 97%, 2-amino-4,6-dichloro-pyrimidine-5-carboxylic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg.
2-amino-4,6-dichloropyrimidine-5-carboxylic acid (CAS 1555389-67-7) is a chemical compound with the molecular formula C5H3Cl2N3O2 and a molecular weight of 208.00 g/mol. IUPAC name: 2-amino-4,6-dichloropyrimidine-5-carboxylic acid. InChIKey: DTQVMKIYUNUTJJ-UHFFFAOYSA-N.
| Molecular formula | C5H3Cl2N3O2 |
|---|---|
| Molecular weight | 208.00 g/mol |
| IUPAC name | 2-amino-4,6-dichloropyrimidine-5-carboxylic acid |
| InChIKey | DTQVMKIYUNUTJJ-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(N=C1Cl)N)Cl)C(=O)O |
Computed by PubChem (NCBI)