CAS 1207176-09-7 is the registry number for 5-Amino-2,6-dichloropyrimidine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.
5-amino-2,6-dichloropyrimidine-4-carboxylic acid (CAS 1207176-09-7) is a chemical compound with the molecular formula C5H3Cl2N3O2 and a molecular weight of 208.00 g/mol. IUPAC name: 5-amino-2,6-dichloropyrimidine-4-carboxylic acid. InChIKey: YFYJIAXOWOBLMC-UHFFFAOYSA-N.
| Molecular formula | C5H3Cl2N3O2 |
|---|---|
| Molecular weight | 208.00 g/mol |
| IUPAC name | 5-amino-2,6-dichloropyrimidine-4-carboxylic acid |
| InChIKey | YFYJIAXOWOBLMC-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(N=C1Cl)Cl)C(=O)O)N |
Computed by PubChem (NCBI)