Products 1632286-29-3

CAS 1632286-29-3 is the registry number for 5-Amino-3,6-dichloropyrazine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

5-amino-3,6-dichloropyrazine-2-carboxylic acid (CAS 1632286-29-3) is a chemical compound with the molecular formula C5H3Cl2N3O2 and a molecular weight of 208.00 g/mol. IUPAC name: 5-amino-3,6-dichloropyrazine-2-carboxylic acid. InChIKey: NFUFJWKZYAZIFF-UHFFFAOYSA-N.

Identity
Molecular formulaC5H3Cl2N3O2
Molecular weight208.00 g/mol
IUPAC name5-amino-3,6-dichloropyrazine-2-carboxylic acid
InChIKeyNFUFJWKZYAZIFF-UHFFFAOYSA-N
SMILESC1(=C(N=C(C(=N1)Cl)N)Cl)C(=O)O

Computed by PubChem (NCBI)