CAS 4853-52-5 appears in our catalog under these names: 3-Amino-5,6-dichloropyrazine-2-carboxylic acid, 95%, 95%, 3-Amino-5,6-dichloropyrazine-2-carboxylic acid, 98%, 3-Amino-5,6-dichloropyrazine-2-carboxylic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 500mg, 2.5g.
3-amino-5,6-dichloropyrazine-2-carboxylic acid (CAS 4853-52-5) is a chemical compound with the molecular formula C5H3Cl2N3O2 and a molecular weight of 208.00 g/mol. IUPAC name: 3-amino-5,6-dichloropyrazine-2-carboxylic acid. InChIKey: UFOUSHWZVOIJKK-UHFFFAOYSA-N.
| Molecular formula | C5H3Cl2N3O2 |
|---|---|
| Molecular weight | 208.00 g/mol |
| IUPAC name | 3-amino-5,6-dichloropyrazine-2-carboxylic acid |
| InChIKey | UFOUSHWZVOIJKK-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(C(=N1)Cl)Cl)N)C(=O)O |
Computed by PubChem (NCBI)