CAS 2587-03-3 is the registry number for 2,6-Dichloro-4-nitraminopyridine. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
N-(2,6-dichloro-4-pyridinyl)nitramide (CAS 2587-03-3) is a chemical compound with the molecular formula C5H3Cl2N3O2 and a molecular weight of 208.00 g/mol. IUPAC name: N-(2,6-dichloro-4-pyridinyl)nitramide. InChIKey: QFHVOEQUMGNHPU-UHFFFAOYSA-N.
| Molecular formula | C5H3Cl2N3O2 |
|---|---|
| Molecular weight | 208.00 g/mol |
| IUPAC name | N-(2,6-dichloro-4-pyridinyl)nitramide |
| InChIKey | QFHVOEQUMGNHPU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1Cl)Cl)N[N+](=O)[O-] |
Computed by PubChem (NCBI)