CAS 1823354-61-5 is the registry number for Methyl 3,5-dichloro-1,2,4-triazine-6-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3,5-dichloro-1,2,4-triazine-6-carboxylate (CAS 1823354-61-5) is a chemical compound with the molecular formula C5H3Cl2N3O2 and a molecular weight of 208.00 g/mol. IUPAC name: methyl 3,5-dichloro-1,2,4-triazine-6-carboxylate. InChIKey: ILGMUAPZWNFLMX-UHFFFAOYSA-N.
| Molecular formula | C5H3Cl2N3O2 |
|---|---|
| Molecular weight | 208.00 g/mol |
| IUPAC name | methyl 3,5-dichloro-1,2,4-triazine-6-carboxylate |
| InChIKey | ILGMUAPZWNFLMX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=C(N=N1)Cl)Cl |
Computed by PubChem (NCBI)