CAS 13162-26-0 appears in our catalog under these names: 2,4-Dichloro-6-methyl-5-nitropyrimidine, 2,4–Dichloro–6–methyl–5–nitropyrimidine, 2,4-Dichloro-6-methyl-5-nitropyrimidine 98%, 2,4-Dichloro-6-methyl-5-nitropyrimidine, 98%, 98%, 2,4-Dichloro-6-methyl-5-nitropyrimidine, 98%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1000g, 1g, 100g, 500g, 1kg.
2,4-dichloro-6-methyl-5-nitropyrimidine (CAS 13162-26-0) is a chemical compound with the molecular formula C5H3Cl2N3O2 and a molecular weight of 208.00 g/mol. IUPAC name: 2,4-dichloro-6-methyl-5-nitropyrimidine. InChIKey: NBCOZXBHPKSFSA-UHFFFAOYSA-N.
| Molecular formula | C5H3Cl2N3O2 |
|---|---|
| Molecular weight | 208.00 g/mol |
| IUPAC name | 2,4-dichloro-6-methyl-5-nitropyrimidine |
| InChIKey | NBCOZXBHPKSFSA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=N1)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)