cas: 247564-66-5 — see every product listed under this CAS number, including other names
4,6-Difluoroindole-2-carboxylic acid, 97% (CAS 247564-66-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F050360-1G |
| cas | 247564-66-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 331.15 Pln | |
| Fluorochem | 10g | 534.20 Pln | |
| Fluorochem | 25g | 1195.43 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4,6-difluoro-1H-indole-2-carboxylic acid (CAS 247564-66-5) is a chemical compound with the molecular formula C9H5F2NO2 and a molecular weight of 197.14 g/mol. IUPAC name: 4,6-difluoro-1H-indole-2-carboxylic acid. InChIKey: OCHGGXDZJGAUEU-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO2 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 4,6-difluoro-1H-indole-2-carboxylic acid |
| InChIKey | OCHGGXDZJGAUEU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=C2)C(=O)O)F)F |
Computed by PubChem (NCBI)