CAS 2379322-48-0 is the registry number for 3,5-Difluoro-4-(oxazol-5-yl)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
3,5-difluoro-4-(1,3-oxazol-5-yl)phenol (CAS 2379322-48-0) is a chemical compound with the molecular formula C9H5F2NO2 and a molecular weight of 197.14 g/mol. IUPAC name: 3,5-difluoro-4-(1,3-oxazol-5-yl)phenol. InChIKey: QXTVYTAINPEMNC-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO2 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 3,5-difluoro-4-(1,3-oxazol-5-yl)phenol |
| InChIKey | QXTVYTAINPEMNC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C2=CN=CO2)F)O |
Computed by PubChem (NCBI)