CAS 1374358-06-1 is the registry number for 4-Cyano-2,5-difluorophenylacetic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-cyano-2,5-difluorophenyl)acetic acid (CAS 1374358-06-1) is a chemical compound with the molecular formula C9H5F2NO2 and a molecular weight of 197.14 g/mol. IUPAC name: 2-(4-cyano-2,5-difluorophenyl)acetic acid. InChIKey: RFTTZZZIURDXEQ-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO2 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 2-(4-cyano-2,5-difluorophenyl)acetic acid |
| InChIKey | RFTTZZZIURDXEQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)C#N)F)CC(=O)O |
Computed by PubChem (NCBI)