Products 1374358-06-1

CAS 1374358-06-1 is the registry number for 4-Cyano-2,5-difluorophenylacetic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(4-cyano-2,5-difluorophenyl)acetic acid (CAS 1374358-06-1) is a chemical compound with the molecular formula C9H5F2NO2 and a molecular weight of 197.14 g/mol. IUPAC name: 2-(4-cyano-2,5-difluorophenyl)acetic acid. InChIKey: RFTTZZZIURDXEQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5F2NO2
Molecular weight197.14 g/mol
IUPAC name2-(4-cyano-2,5-difluorophenyl)acetic acid
InChIKeyRFTTZZZIURDXEQ-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1F)C#N)F)CC(=O)O

Computed by PubChem (NCBI)