Products 1261358-84-2
CAS 1261358-84-2 appears in our catalog under these names: 2–(4–cyanophenyl)–2，2–difluoroacetic acid, 2-(4-Cyanophenyl)-2,2-difluoroacetic acid, 95%, 2-(4-Cyanophenyl)-2,2-difluoroacetic acid 95%, 2-(4-Cyanophenyl)-2,2-difluoroacetic Acid, 95%, 95%, (4-Cyanophenyl)(difluoro)acetic acid, 95%. Offered by: GLPBio, AmBeed, Fluorochem, Chemat, Combi-blocks. Available pack sizes: 1g, 250mg, 25g, 5g, 10g, 100mg.
2-(4-cyanophenyl)-2,2-difluoroacetic acid (CAS 1261358-84-2) is a chemical compound with the molecular formula C9H5F2NO2 and a molecular weight of 197.14 g/mol. IUPAC name: 2-(4-cyanophenyl)-2,2-difluoroacetic acid. InChIKey: YNJRLINCQPOYJK-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO2 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 2-(4-cyanophenyl)-2,2-difluoroacetic acid |
| InChIKey | YNJRLINCQPOYJK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)