Products 1249974-01-3
CAS 1249974-01-3 appears in our catalog under these names: 2–(3–cyanophenyl)–2，2–difluoroacetic acid, 2-(3-Cyanophenyl)-2,2-difluoroacetic acid, 2-(3-Cyanophenyl)-2,2-difluoroacetic acid, 95%, 2-(3-Cyanophenyl)-2,2-difluoroacetic Acid, 98%, 2-(3-Cyanophenyl)-2,2-difluoroacetic Acid, ≥95%, ≥95%. Offered by: GLPBio, Fluorochem, Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
2-(3-cyanophenyl)-2,2-difluoroacetic acid (CAS 1249974-01-3) is a chemical compound with the molecular formula C9H5F2NO2 and a molecular weight of 197.14 g/mol. IUPAC name: 2-(3-cyanophenyl)-2,2-difluoroacetic acid. InChIKey: KAAGTQJOVCSSQR-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO2 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 2-(3-cyanophenyl)-2,2-difluoroacetic acid |
| InChIKey | KAAGTQJOVCSSQR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(C(=O)O)(F)F)C#N |
Computed by PubChem (NCBI)