CAS 247564-66-5 appears in our catalog under these names: 4,6-Difluoroindole-2-carboxylic acid, 98%, 1H-Indole-2-carboxylic acid, 4,6-difluoro-, 97%, 97%, 4,6-Difluoroindole-2-carboxylic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 250mg, 50g, 500g.
4,6-difluoro-1H-indole-2-carboxylic acid (CAS 247564-66-5) is a chemical compound with the molecular formula C9H5F2NO2 and a molecular weight of 197.14 g/mol. IUPAC name: 4,6-difluoro-1H-indole-2-carboxylic acid. InChIKey: OCHGGXDZJGAUEU-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO2 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 4,6-difluoro-1H-indole-2-carboxylic acid |
| InChIKey | OCHGGXDZJGAUEU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=C2)C(=O)O)F)F |
Computed by PubChem (NCBI)