CAS 1805664-26-9 appears in our catalog under these names: Methyl 3-cyano-2,4-difluorobenzoate, 95%, Methyl 3-cyano-2,4-difluorobenzoate, ≥95%, ≥95%, Methyl 3-cyano-2,4-difluorobenzoate. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
Methyl 3-cyano-2,4-difluorobenzoate (CAS 1805664-26-9) is a chemical compound with the molecular formula C9H5F2NO2 and a molecular weight of 197.14 g/mol. IUPAC name: methyl 3-cyano-2,4-difluorobenzoate. InChIKey: JCEMJYDKHJMHQS-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO2 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | methyl 3-cyano-2,4-difluorobenzoate |
| InChIKey | JCEMJYDKHJMHQS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)F)C#N)F |
Computed by PubChem (NCBI)