CAS 331281-44-8 appears in our catalog under these names: Methyl 2-cyano-4,5-difluorobenzoate, 98%, Methyl 2-cyano-4,5-difluorobenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Methyl 2-cyano-4,5-difluorobenzoate (CAS 331281-44-8) is a chemical compound with the molecular formula C9H5F2NO2 and a molecular weight of 197.14 g/mol. IUPAC name: methyl 2-cyano-4,5-difluorobenzoate. InChIKey: YDQRRCIXAPHXNP-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO2 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | methyl 2-cyano-4,5-difluorobenzoate |
| InChIKey | YDQRRCIXAPHXNP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1C#N)F)F |
Computed by PubChem (NCBI)