4,6-Dihydroxyquinoline-3-carboxylic acid, 95+%
cas: 83475-08-5 — see every product listed under this CAS number, including other names
4,6-Dihydroxyquinoline-3-carboxylic acid, 95+% (CAS 83475-08-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A647623-100mg |
| cas | 83475-08-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 954.44 Pln | |
| Ambeed | 1g | 2461.88 Pln | |
| Chemat | 100mg | 573.20 Pln | |
| Chemat | 250mg | 981.20 Pln | |
| Chemat | 1g | 2541.20 Pln | |
| BLDpharm | 100mg | 608.70 Pln | |
| BLDpharm | 250mg | 1025.22 Pln | |
| BLDpharm | 1g | 2646.87 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
6-hydroxy-4-oxo-1H-quinoline-3-carboxylic acid (CAS 83475-08-5) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 6-hydroxy-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: FDTKSXZUNFFUTD-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 6-hydroxy-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | FDTKSXZUNFFUTD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C(=O)C(=CN2)C(=O)O |
Computed by PubChem (NCBI)