cas: 153039-17-9 — see every product listed under this CAS number, including other names
4–Boc–amino–2,2–dimethylbutyric acid (CAS 153039-17-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC67362-1g |
| cas | 153039-17-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 5708.15 Pln | |
| GLPBio | 250mg | 2520.73 Pln | |
| GLPBio | 5g | 16295.44 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 153039-17-9) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: TWMVVJUXUMIAAJ-UHFFFAOYSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | TWMVVJUXUMIAAJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC(C)(C)C(=O)O |
Computed by PubChem (NCBI)