cas: 153039-17-9 — see every product listed under this CAS number, including other names
Boc-4-amino-2,2-dimethyl-butyric acid, 98% (CAS 153039-17-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F494268-100MG |
| cas | 153039-17-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 456.11 Pln | |
| Fluorochem | 250mg | 581.06 Pln | |
| Fluorochem | 1g | 1372.45 Pln | |
| Fluorochem | 5g | 6631.02 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 153039-17-9) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: TWMVVJUXUMIAAJ-UHFFFAOYSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | TWMVVJUXUMIAAJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC(C)(C)C(=O)O |
Computed by PubChem (NCBI)