cas: 153039-17-9 — see every product listed under this CAS number, including other names
4-[[(1,1-Dimethylethoxy)carbonyl]amino]-2,2-dimethylbutanoic acid, 99%, 99% (CAS 153039-17-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148QT-100mg |
| cas | 153039-17-9 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 352.40 Pln | |
| Chemat | 250mg | 554.00 Pln | |
| Chemat | 1g | 1288.40 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 153039-17-9) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: TWMVVJUXUMIAAJ-UHFFFAOYSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | TWMVVJUXUMIAAJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC(C)(C)C(=O)O |
Computed by PubChem (NCBI)