cas: 153039-17-9 — see every product listed under this CAS number, including other names
4-Boc-amino-2,2-dimethylbutyric acid, 98.0% (CAS 153039-17-9) is a chemical reagent available from Chemat. Available pack sizes: 250 mg, 100 mg, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W090446-250 mg |
| cas | 153039-17-9 |
| size | 250 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 250 mg | 1336.73 Pln | |
| MedChemExpress | 100 mg | 835.18 Pln | |
| MedChemExpress | 1 g | 3166.46 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 153039-17-9) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: TWMVVJUXUMIAAJ-UHFFFAOYSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | TWMVVJUXUMIAAJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC(C)(C)C(=O)O |
Computed by PubChem (NCBI)