4-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)butanoic acid, 99.50%
cas: 221124-57-8 — see every product listed under this CAS number, including other names
4-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)butanoic acid, 99.50% (CAS 221124-57-8) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 250 mg, 10 g, 100 mg, 5 g, 1 g, 500 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W077284-25 g |
| cas | 221124-57-8 |
| size | 25 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 2832.10 Pln | |
| MedChemExpress | 250 mg | 333.62 Pln | |
| MedChemExpress | 10 g | 1485.34 Pln | |
| MedChemExpress | 100 mg | 240.74 Pln | |
| MedChemExpress | 5 g | 960.56 Pln | |
| MedChemExpress | 1 g | 551.89 Pln | |
| MedChemExpress | 500 mg | 421.86 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.50% |
4-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid (CAS 221124-57-8) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: 4-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid. InChIKey: FBMGMJCITYNTQX-UHFFFAOYSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 4-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid |
| InChIKey | FBMGMJCITYNTQX-UHFFFAOYSA-N |
| SMILES | CN(CCCC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)
Synonyms:
4-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)butanoic acid, 4-({[(9H-fluoren-9-yl)methoxy]carbonyl}(methyl)amino)butanoic acid, FMoc-N-Me-Abu(4)-OH, Fmoc-meabu(4)-OH, Fmoc-N-Methyl-gamma-butyric acid, Fmoc-N-methyl-gamma-aminobutyric acid, 4-[Fmoc-(methyl)amino]butanoic Acid, N-Fmoc-4-methylamino-butanoic acid, 4-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid, Fmoc-N-Me-ABU