cas: 545424-46-2 — see every product listed under this CAS number, including other names
4-(1,3,4-Oxadiazol-2-yl)benzaldehyde, 97% (CAS 545424-46-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F636956-100MG |
| cas | 545424-46-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 351.98 Pln | |
| Fluorochem | 250mg | 529.00 Pln | |
| Fluorochem | 1g | 1039.24 Pln | |
| Fluorochem | 5g | 4579.66 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-(1,3,4-oxadiazol-2-yl)benzaldehyde (CAS 545424-46-2) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 4-(1,3,4-oxadiazol-2-yl)benzaldehyde. InChIKey: PZQDAKKBCZMUTR-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 4-(1,3,4-oxadiazol-2-yl)benzaldehyde |
| InChIKey | PZQDAKKBCZMUTR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=NN=CO2 |
Computed by PubChem (NCBI)