cas: 162848-16-0 — see every product listed under this CAS number, including other names
4-(1H-1,2,4-Triazol-1-yl)benzoic acid, 95% (CAS 162848-16-0) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 10g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC18601CB |
| cas | 162848-16-0 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 168.00 Pln | |
| Thermo Scientific | 1g | 360.94 Pln | |
| Thermo Scientific | 10g | 2000.68 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
4-(1,2,4-triazol-1-yl)benzoic acid (CAS 162848-16-0) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 4-(1,2,4-triazol-1-yl)benzoic acid. InChIKey: FOMQQGKCPYKKHQ-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 4-(1,2,4-triazol-1-yl)benzoic acid |
| InChIKey | FOMQQGKCPYKKHQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N2C=NC=N2 |
Computed by PubChem (NCBI)