cas: 162848-16-0 — see every product listed under this CAS number, including other names
4-[1,2,4]Triazol-1-yl-benzoic acid, 95%, 95% (CAS 162848-16-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112THA-100mg |
| cas | 162848-16-0 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 347.60 Pln | |
| Chemat | 10g | 558.80 Pln | |
| Chemat | 25g | 1034.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(1,2,4-triazol-1-yl)benzoic acid (CAS 162848-16-0) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 4-(1,2,4-triazol-1-yl)benzoic acid. InChIKey: FOMQQGKCPYKKHQ-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 4-(1,2,4-triazol-1-yl)benzoic acid |
| InChIKey | FOMQQGKCPYKKHQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N2C=NC=N2 |
Computed by PubChem (NCBI)