cas: 864244-98-4 — see every product listed under this CAS number, including other names
4-(2-Methyl-4-nitrophenoxy)pyridin-2-amine, 95% (CAS 864244-98-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg. Offered by: Combi-blocks, Ambeed, BLDpharm, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | QV-9508-5g |
| cas | 864244-98-4 |
| size | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Ambeed | 250mg | 1377.19 Pln | |
| Ambeed | 1g | 2689.94 Pln | |
| Ambeed | 5g | 7929.81 Pln | |
| BLDpharm | 100mg | 708.66 Pln | |
| BLDpharm | 250mg | 1480.61 Pln | |
| BLDpharm | 1g | 2896.78 Pln | |
| BLDpharm | 5g | 8544.79 Pln | |
| Chemat | 100mg | 808.40 Pln | |
| Chemat | 250mg | 1701.20 Pln | |
| Chemat | 1g | 3338.00 Pln | |
| Fluorochem | 100mg | 1497.41 Pln | |
| Fluorochem | 250mg | 3168.69 Pln | |
| Fluorochem | 1g | 6198.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-(2-methyl-4-nitrophenoxy)pyridin-2-amine (CAS 864244-98-4) is a chemical compound with the molecular formula C12H11N3O3 and a molecular weight of 245.23 g/mol. IUPAC name: 4-(2-methyl-4-nitrophenoxy)pyridin-2-amine. InChIKey: ZZTYDAVBBQOEOR-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O3 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 4-(2-methyl-4-nitrophenoxy)pyridin-2-amine |
| InChIKey | ZZTYDAVBBQOEOR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)[N+](=O)[O-])OC2=CC(=NC=C2)N |
Computed by PubChem (NCBI)