Products 51649-69-5
CAS 51649-69-5 appears in our catalog under these names: 5-(Acetylamino)-1-phenyl-1h-pyrazole-4-carboxylic acid, 95%, 5-(Acetylamino)-1-phenyl-1H-pyrazole-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 5g, 250mg, 1000mg, 500mg, 2000mg.
5-acetamido-1-phenylpyrazole-4-carboxylic acid (CAS 51649-69-5) is a chemical compound with the molecular formula C12H11N3O3 and a molecular weight of 245.23 g/mol. IUPAC name: 5-acetamido-1-phenylpyrazole-4-carboxylic acid. InChIKey: ZPBKDFIGECOWFC-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O3 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 5-acetamido-1-phenylpyrazole-4-carboxylic acid |
| InChIKey | ZPBKDFIGECOWFC-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=NN1C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)