CAS 864244-98-4 appears in our catalog under these names: 4-(2-Methyl-4-nitrophenoxy)pyridin-2-amine, 95%, 4-(2-Methyl-4-nitrophenoxy)pyridin-2-amine 95%, 4-(2-Methyl-4-nitrophenoxy)pyridin-2-amine, 95%, 95%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
4-(2-methyl-4-nitrophenoxy)pyridin-2-amine (CAS 864244-98-4) is a chemical compound with the molecular formula C12H11N3O3 and a molecular weight of 245.23 g/mol. IUPAC name: 4-(2-methyl-4-nitrophenoxy)pyridin-2-amine. InChIKey: ZZTYDAVBBQOEOR-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O3 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 4-(2-methyl-4-nitrophenoxy)pyridin-2-amine |
| InChIKey | ZZTYDAVBBQOEOR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)[N+](=O)[O-])OC2=CC(=NC=C2)N |
Computed by PubChem (NCBI)