CAS 188944-35-6 is the registry number for 4-Maleimidophenylacetic acid hydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-[4-(2,5-dioxopyrrol-1-yl)phenyl]acetohydrazide (CAS 188944-35-6) is a chemical compound with the molecular formula C12H11N3O3 and a molecular weight of 245.23 g/mol. IUPAC name: 2-[4-(2,5-dioxopyrrol-1-yl)phenyl]acetohydrazide. InChIKey: LVCRRPOBKJECNL-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O3 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 2-[4-(2,5-dioxopyrrol-1-yl)phenyl]acetohydrazide |
| InChIKey | LVCRRPOBKJECNL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)NN)N2C(=O)C=CC2=O |
Computed by PubChem (NCBI)