CAS 65906-67-4 is the registry number for N-Benzyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-benzyl-2,4-dioxo-1H-pyrimidine-5-carboxamide (CAS 65906-67-4) is a chemical compound with the molecular formula C12H11N3O3 and a molecular weight of 245.23 g/mol. IUPAC name: N-benzyl-2,4-dioxo-1H-pyrimidine-5-carboxamide. InChIKey: NUCVHPZNCBEPER-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O3 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | N-benzyl-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| InChIKey | NUCVHPZNCBEPER-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C2=CNC(=O)NC2=O |
Computed by PubChem (NCBI)