Products 30491-74-8
CAS 30491-74-8 appears in our catalog under these names: 3,4'-Diamino-4-nitrodiphenyl ether, 95%, 3，4'–Diamino–4–nitrodiphenyl Ether, 3,4'-Diamino-4-nitrodiphenyl Ether, >98.0%(GC). Offered by: Combi-blocks, GLPBio, TCI. Available pack sizes: 5g, 1g.
5-(4-aminophenoxy)-2-nitroaniline (CAS 30491-74-8) is a chemical compound with the molecular formula C12H11N3O3 and a molecular weight of 245.23 g/mol. IUPAC name: 5-(4-aminophenoxy)-2-nitroaniline. InChIKey: ZHELWQKSRPWTPN-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O3 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 5-(4-aminophenoxy)-2-nitroaniline |
| InChIKey | ZHELWQKSRPWTPN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)OC2=CC(=C(C=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)