Products 1401319-18-3

CAS 1401319-18-3 is the registry number for 1-(1H-Indazol-3-yl)-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(1H-indazol-3-yl)-5-oxopyrrolidine-3-carboxylic acid (CAS 1401319-18-3) is a chemical compound with the molecular formula C12H11N3O3 and a molecular weight of 245.23 g/mol. IUPAC name: 1-(1H-indazol-3-yl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: OBVACFNORHOAKT-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11N3O3
Molecular weight245.23 g/mol
IUPAC name1-(1H-indazol-3-yl)-5-oxopyrrolidine-3-carboxylic acid
InChIKeyOBVACFNORHOAKT-UHFFFAOYSA-N
SMILESC1C(CN(C1=O)C2=NNC3=CC=CC=C32)C(=O)O

Computed by PubChem (NCBI)