cas: 28999-69-1 — see every product listed under this CAS number, including other names
4-(4-Aminophenoxy)benzoic acid 96% (CAS 28999-69-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A674091-250mg |
| cas | 28999-69-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 743.06 Pln | |
| Ambeed | 1g | 1115.75 Pln | |
| Ambeed | 5g | 3062.62 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A674091 |
4-(4-aminophenoxy)benzoic acid (CAS 28999-69-1) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 4-(4-aminophenoxy)benzoic acid. InChIKey: DVFCGSZRLJQHJA-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 4-(4-aminophenoxy)benzoic acid |
| InChIKey | DVFCGSZRLJQHJA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)