cas: 30098-34-1 — see every product listed under this CAS number, including other names
4-(4-Bromo-2,5-dimethylphenyl)-4-oxobutanoic acid 95% (CAS 30098-34-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A215912-1g |
| cas | 30098-34-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 492.75 Pln | |
| Ambeed | 25g | 1577.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A215912 |
4-(4-bromo-2,5-dimethylphenyl)-4-oxobutanoic acid (CAS 30098-34-1) is a chemical compound with the molecular formula C12H13BrO3 and a molecular weight of 285.13 g/mol. IUPAC name: 4-(4-bromo-2,5-dimethylphenyl)-4-oxobutanoic acid. InChIKey: LLRQYYLOSBQVAO-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO3 |
|---|---|
| Molecular weight | 285.13 g/mol |
| IUPAC name | 4-(4-bromo-2,5-dimethylphenyl)-4-oxobutanoic acid |
| InChIKey | LLRQYYLOSBQVAO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)C)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)