cas: 30098-34-1 — see every product listed under this CAS number, including other names
4-(4-Bromo-2,5-dimethylphenyl)-4-oxobutanoic acid, 95%, 95% (CAS 30098-34-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I6MT-1g |
| cas | 30098-34-1 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 510.80 Pln | |
| Chemat | 10g | 846.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(4-bromo-2,5-dimethylphenyl)-4-oxobutanoic acid (CAS 30098-34-1) is a chemical compound with the molecular formula C12H13BrO3 and a molecular weight of 285.13 g/mol. IUPAC name: 4-(4-bromo-2,5-dimethylphenyl)-4-oxobutanoic acid. InChIKey: LLRQYYLOSBQVAO-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO3 |
|---|---|
| Molecular weight | 285.13 g/mol |
| IUPAC name | 4-(4-bromo-2,5-dimethylphenyl)-4-oxobutanoic acid |
| InChIKey | LLRQYYLOSBQVAO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)C)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)