cas: 860612-51-7 — see every product listed under this CAS number, including other names
4-(4-Bromophenyl)-5-methyl-2,4-dihydro-3H-1,2,4-triazol-3-one, 98%, 98% (CAS 860612-51-7) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250g, 500g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12XAEJ-100g |
| cas | 860612-51-7 |
| size | 100g |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 5219.60 Pln | |
| Chemat | 250g | 10389.20 Pln | |
| Chemat | 500g | 18585.60 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 890.00 Pln | |
| Chemat | 10g | 1648.40 Pln | |
| Chemat | 25g | 3578.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(4-bromophenyl)-3-methyl-1H-1,2,4-triazol-5-one (CAS 860612-51-7) is a chemical compound with the molecular formula C9H8BrN3O and a molecular weight of 254.08 g/mol. IUPAC name: 4-(4-bromophenyl)-3-methyl-1H-1,2,4-triazol-5-one. InChIKey: XLXZEMLCFRJAED-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3O |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 4-(4-bromophenyl)-3-methyl-1H-1,2,4-triazol-5-one |
| InChIKey | XLXZEMLCFRJAED-UHFFFAOYSA-N |
| SMILES | CC1=NNC(=O)N1C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)