CAS 860612-51-7 appears in our catalog under these names: 4-(4-Bromophenyl)-5-methyl-2,4-dihydro-3H-1,2,4-triazol-3-one, 98%, 98%, 4-(4-Bromophenyl)-5-methyl-2,4-dihydro-3H-1,2,4-triazol-3-one, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100g, 250g, 500g, 100mg, 250mg, 1g, 5g, 10g.
4-(4-bromophenyl)-3-methyl-1H-1,2,4-triazol-5-one (CAS 860612-51-7) is a chemical compound with the molecular formula C9H8BrN3O and a molecular weight of 254.08 g/mol. IUPAC name: 4-(4-bromophenyl)-3-methyl-1H-1,2,4-triazol-5-one. InChIKey: XLXZEMLCFRJAED-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3O |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 4-(4-bromophenyl)-3-methyl-1H-1,2,4-triazol-5-one |
| InChIKey | XLXZEMLCFRJAED-UHFFFAOYSA-N |
| SMILES | CC1=NNC(=O)N1C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)