4-(4-Cyanophenoxy)benzoic acid, 97%
cas: 50793-29-8 — see every product listed under this CAS number, including other names
4-(4-Cyanophenoxy)benzoic acid, 97% (CAS 50793-29-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A462913-250mg |
| cas | 50793-29-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 364.81 Pln | |
| Ambeed | 1g | 865.44 Pln | |
| Ambeed | 5g | 2856.81 Pln | |
| BLDpharm | 250mg | 392.11 Pln | |
| BLDpharm | 1g | 925.25 Pln | |
| BLDpharm | 5g | 3074.50 Pln | |
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 1g | 659.60 Pln | |
| Fluorochem | 250mg | 508.17 Pln | |
| Fluorochem | 1g | 1216.26 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
4-(4-cyanophenoxy)benzoic acid (CAS 50793-29-8) is a chemical compound with the molecular formula C14H9NO3 and a molecular weight of 239.23 g/mol. IUPAC name: 4-(4-cyanophenoxy)benzoic acid. InChIKey: JBBCZYHRHADVJB-UHFFFAOYSA-N.
| Molecular formula | C14H9NO3 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 4-(4-cyanophenoxy)benzoic acid |
| InChIKey | JBBCZYHRHADVJB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)OC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)