CAS 50793-29-8 appears in our catalog under these names: 4-(4-Cyanophenoxy)benzoic acid, 95%, 4-(4-Cyanophenoxy)benzoic acid, 97%, 97%, 4-(4-cyanophenoxy)benzoic acid, 9500%, 4-(4-Cyanophenoxy)benzoic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg.
4-(4-cyanophenoxy)benzoic acid (CAS 50793-29-8) is a chemical compound with the molecular formula C14H9NO3 and a molecular weight of 239.23 g/mol. IUPAC name: 4-(4-cyanophenoxy)benzoic acid. InChIKey: JBBCZYHRHADVJB-UHFFFAOYSA-N.
| Molecular formula | C14H9NO3 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 4-(4-cyanophenoxy)benzoic acid |
| InChIKey | JBBCZYHRHADVJB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)OC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)