cas: 1197193-38-6 — see every product listed under this CAS number, including other names
4-(4-Pyridyl)aniline DiHCl (CAS 1197193-38-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111PJV-250mg |
| cas | 1197193-38-6 |
| size | 250mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 597.20 Pln | |
| Chemat | 1g | 1754.00 Pln |
| delivery time | 3 weeks |
|---|
4-pyridin-4-ylaniline;dihydrochloride (CAS 1197193-38-6) is a chemical compound with the molecular formula C11H12Cl2N2 and a molecular weight of 243.13 g/mol. IUPAC name: 4-pyridin-4-ylaniline;dihydrochloride. InChIKey: CFNGVKLTESTAAV-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2 |
|---|---|
| Molecular weight | 243.13 g/mol |
| IUPAC name | 4-pyridin-4-ylaniline;dihydrochloride |
| InChIKey | CFNGVKLTESTAAV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=NC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)