CAS 1185304-76-0 appears in our catalog under these names: 8-Chloro-2,3,4,5-tetrahydro-1h-pyrido[4,3-b]indole hydrochloride, 95%, 8-Chloro-2,3,4,5-tetrahydro-1H-pyrido-(4,3-b)-indole hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 2,5g.
8-chloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;hydrochloride (CAS 1185304-76-0) is a chemical compound with the molecular formula C11H12Cl2N2 and a molecular weight of 243.13 g/mol. IUPAC name: 8-chloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;hydrochloride. InChIKey: CUJJNHSGYOSNTL-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2 |
|---|---|
| Molecular weight | 243.13 g/mol |
| IUPAC name | 8-chloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;hydrochloride |
| InChIKey | CUJJNHSGYOSNTL-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1NC3=C2C=C(C=C3)Cl.Cl |
Computed by PubChem (NCBI)