CAS 2306275-93-2 is the registry number for 2-(2,3-Dichlorophenyl)-2,6-diazaspiro[3.3]heptane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,3-dichlorophenyl)-2,6-diazaspiro[3.3]heptane (CAS 2306275-93-2) is a chemical compound with the molecular formula C11H12Cl2N2 and a molecular weight of 243.13 g/mol. IUPAC name: 2-(2,3-dichlorophenyl)-2,6-diazaspiro[3.3]heptane. InChIKey: FACRZYQJHRDYMD-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2 |
|---|---|
| Molecular weight | 243.13 g/mol |
| IUPAC name | 2-(2,3-dichlorophenyl)-2,6-diazaspiro[3.3]heptane |
| InChIKey | FACRZYQJHRDYMD-UHFFFAOYSA-N |
| SMILES | C1C2(CN1)CN(C2)C3=C(C(=CC=C3)Cl)Cl |
Computed by PubChem (NCBI)