Products 1246767-56-5

CAS 1246767-56-5 is the registry number for 6-Phenylpyridin-3-amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

6-phenylpyridin-3-amine;dihydrochloride (CAS 1246767-56-5) is a chemical compound with the molecular formula C11H12Cl2N2 and a molecular weight of 243.13 g/mol. IUPAC name: 6-phenylpyridin-3-amine;dihydrochloride. InChIKey: MMWLZANHNOERGB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12Cl2N2
Molecular weight243.13 g/mol
IUPAC name6-phenylpyridin-3-amine;dihydrochloride
InChIKeyMMWLZANHNOERGB-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NC=C(C=C2)N.Cl.Cl

Computed by PubChem (NCBI)