CAS 299165-92-7 appears in our catalog under these names: 2-(4,6-Dichloro-2-methyl-1h-indol-3-yl)-ethylamine, 95%, 2–(4,6–Dichloro–2–methyl–1H–indol–3–yl)ethanamine, DCAI. Offered by: Combi-blocks, GLPBio, TargetMol, MedChemExpress. Available pack sizes: 5g, 1g, 250mg, 1mg, 5mg, 10mg, 25mg, 50mg.
2-(4,6-dichloro-2-methyl-1H-indol-3-yl)ethanamine (CAS 299165-92-7) is a chemical compound with the molecular formula C11H12Cl2N2 and a molecular weight of 243.13 g/mol. IUPAC name: 2-(4,6-dichloro-2-methyl-1H-indol-3-yl)ethanamine. InChIKey: JCTJISIFGZHOFY-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2 |
|---|---|
| Molecular weight | 243.13 g/mol |
| IUPAC name | 2-(4,6-dichloro-2-methyl-1H-indol-3-yl)ethanamine |
| InChIKey | JCTJISIFGZHOFY-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C=C(C=C2Cl)Cl)CCN |
Computed by PubChem (NCBI)