Products 1197193-38-6
CAS 1197193-38-6 appears in our catalog under these names: 4-(4-Pyridyl)aniline dihydrochloride, 95%, 4-(Pyridin-4-yl)aniline dihydrochloride, 95+%, 4–(4–Pyridyl)aniline Dihydrochloride, 4-(4-Pyridyl)aniline DiHCl, 4-(Pyridin-4-yl)aniline dihydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
4-pyridin-4-ylaniline;dihydrochloride (CAS 1197193-38-6) is a chemical compound with the molecular formula C11H12Cl2N2 and a molecular weight of 243.13 g/mol. IUPAC name: 4-pyridin-4-ylaniline;dihydrochloride. InChIKey: CFNGVKLTESTAAV-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2 |
|---|---|
| Molecular weight | 243.13 g/mol |
| IUPAC name | 4-pyridin-4-ylaniline;dihydrochloride |
| InChIKey | CFNGVKLTESTAAV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=NC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)