CAS 121872-64-8 appears in our catalog under these names: 5,6-Dichlorogramine, 98%, 1-(5,6-Dichloro-1H-indol-3-yl)-N,N-dimethylmethanamine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
1-(5,6-dichloro-1H-indol-3-yl)-N,N-dimethylmethanamine (CAS 121872-64-8) is a chemical compound with the molecular formula C11H12Cl2N2 and a molecular weight of 243.13 g/mol. IUPAC name: 1-(5,6-dichloro-1H-indol-3-yl)-N,N-dimethylmethanamine. InChIKey: UOSKXEVWJSTQAG-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2 |
|---|---|
| Molecular weight | 243.13 g/mol |
| IUPAC name | 1-(5,6-dichloro-1H-indol-3-yl)-N,N-dimethylmethanamine |
| InChIKey | UOSKXEVWJSTQAG-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=CNC2=CC(=C(C=C21)Cl)Cl |
Computed by PubChem (NCBI)