CAS 1170936-92-1 appears in our catalog under these names: 2-(3-Aminophenyl)pyridine Dihydrochloride, 3–(Pyridin–2–yl)aniline dihydrochloride. Offered by: TRC, GLPBio. Available pack sizes: 250mg, 1g, 5g.
3-pyridin-2-ylaniline;dihydrochloride (CAS 1170936-92-1) is a chemical compound with the molecular formula C11H12Cl2N2 and a molecular weight of 243.13 g/mol. IUPAC name: 3-pyridin-2-ylaniline;dihydrochloride. InChIKey: PJNDCKBACHNFTA-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2 |
|---|---|
| Molecular weight | 243.13 g/mol |
| IUPAC name | 3-pyridin-2-ylaniline;dihydrochloride |
| InChIKey | PJNDCKBACHNFTA-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=CC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)