cas: 25877-46-7 — see every product listed under this CAS number, including other names
4-(5-METHYL-1,3,4-OXADIAZOL-2-YL)PHENOL, 98%, 98% (CAS 25877-46-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117VF8-100mg |
| cas | 25877-46-7 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 366.80 Pln | |
| Chemat | 1g | 674.00 Pln | |
| Chemat | 5g | 1874.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(5-methyl-1,3,4-oxadiazol-2-yl)phenol (CAS 25877-46-7) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 4-(5-methyl-1,3,4-oxadiazol-2-yl)phenol. InChIKey: ZGERZQXLBGWDCL-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 4-(5-methyl-1,3,4-oxadiazol-2-yl)phenol |
| InChIKey | ZGERZQXLBGWDCL-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(O1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)